C30H35ClN4O6 — CID 166148535
1-[3-chloro-5-[2-methyl-4-(2-methyl-1-oxopropan-2-yl)oxybutan-2-yl]phenyl]-3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea (PubChem CID 166148535) has the molecular formula C30H35ClN4O6 and a molecular weight of 583.09 g/mol. Its IUPAC name is 1-[3-chloro-5-[2-methyl-4-(2-methyl-1-oxopropan-2-yl)oxybutan-2-yl]phenyl]-3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea.
| Compound Name | 1-[3-chloro-5-[2-methyl-4-(2-methyl-1-oxopropan-2-yl)oxybutan-2-yl]phenyl]-3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea |
|---|---|
| PubChem CID | 166148535 |
| Molecular Formula | C30H35ClN4O6 |
| Molecular Weight | 583.09 g/mol |
| Exact Mass | 582.22 |
| IUPAC Name | 1-[3-chloro-5-[2-methyl-4-(2-methyl-1-oxopropan-2-yl)oxybutan-2-yl]phenyl]-3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea |
| SMILES | CC(C)(C=O)OCCC(C)(C)c1cc(Cl)cc(NC(=O)NCc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)c1 |
| InChI | InChI=1S/C30H35ClN4O6/c1-29(2,9-10-41-30(3,4)17-36)20-12-21(31)14-22(13-20)33-28(40)32-15-18-5-6-23-19(11-18)16-35(27(23)39)24-7-8-25(37)34-26(24)38/h5-6,11-14,17,24H,7-10,15-16H2,1-4H3,(H2,32,33,40)(H,34,37,38) |
| InChIKey | YVYKEQJAYWBGKE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.09 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|