C30H31N5O4 — CID 176564968
1-[2-(3,5-dimethyl-4-pyridin-3-ylphenyl)propan-2-yl]-3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]urea (PubChem CID 176564968) has the molecular formula C30H31N5O4 and a molecular weight of 525.61 g/mol. Its IUPAC name is 1-[2-(3,5-dimethyl-4-pyridin-3-ylphenyl)propan-2-yl]-3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]urea.
| Compound Name | 1-[2-(3,5-dimethyl-4-pyridin-3-ylphenyl)propan-2-yl]-3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]urea |
|---|---|
| PubChem CID | 176564968 |
| Molecular Formula | C30H31N5O4 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | 1-[2-(3,5-dimethyl-4-pyridin-3-ylphenyl)propan-2-yl]-3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]urea |
| SMILES | Cc1cc(C(C)(C)NC(=O)Nc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)cc(C)c1-c1cccnc1 |
| InChI | InChI=1S/C30H31N5O4/c1-17-12-21(13-18(2)26(17)19-6-5-11-31-15-19)30(3,4)34-29(39)32-22-7-8-23-20(14-22)16-35(28(23)38)24-9-10-25(36)33-27(24)37/h5-8,11-15,24H,9-10,16H2,1-4H3,(H2,32,34,39)(H,33,36,37) |
| InChIKey | RSXDTSIMFDHCMJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|