C29H27N5O5 — CID 176565048
1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-3-[2-[4-(6-methyl-3-pyridinyl)phenyl]propan-2-yl]urea (PubChem CID 176565048) has the molecular formula C29H27N5O5 and a molecular weight of 525.57 g/mol. Its IUPAC name is 1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-3-[2-[4-(6-methyl-3-pyridinyl)phenyl]propan-2-yl]urea.
| Compound Name | 1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-3-[2-[4-(6-methyl-3-pyridinyl)phenyl]propan-2-yl]urea |
|---|---|
| PubChem CID | 176565048 |
| Molecular Formula | C29H27N5O5 |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | 1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-3-[2-[4-(6-methyl-3-pyridinyl)phenyl]propan-2-yl]urea |
| SMILES | Cc1ccc(-c2ccc(C(C)(C)NC(=O)Nc3ccc4c(c3)C(=O)N(C3CCC(=O)NC3=O)C4=O)cc2)cn1 |
| InChI | InChI=1S/C29H27N5O5/c1-16-4-5-18(15-30-16)17-6-8-19(9-7-17)29(2,3)33-28(39)31-20-10-11-21-22(14-20)27(38)34(26(21)37)23-12-13-24(35)32-25(23)36/h4-11,14-15,23H,12-13H2,1-3H3,(H2,31,33,39)(H,32,35,36) |
| InChIKey | GIUOOHMPGREABR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 137.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|