C30H25N5O5S — CID 178049177
1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-3-[2-(4-phenyl-1,3-benzothiazol-2-yl)propan-2-yl]urea (PubChem CID 178049177) has the molecular formula C30H25N5O5S and a molecular weight of 567.63 g/mol. Its IUPAC name is 1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-3-[2-(4-phenyl-1,3-benzothiazol-2-yl)propan-2-yl]urea.
| Compound Name | 1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-3-[2-(4-phenyl-1,3-benzothiazol-2-yl)propan-2-yl]urea |
|---|---|
| PubChem CID | 178049177 |
| Molecular Formula | C30H25N5O5S |
| Molecular Weight | 567.63 g/mol |
| Exact Mass | 567.16 |
| IUPAC Name | 1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-3-[2-(4-phenyl-1,3-benzothiazol-2-yl)propan-2-yl]urea |
| SMILES | CC(C)(NC(=O)Nc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O)c1nc2c(-c3ccccc3)cccc2s1 |
| InChI | InChI=1S/C30H25N5O5S/c1-30(2,28-33-24-18(9-6-10-22(24)41-28)16-7-4-3-5-8-16)34-29(40)31-17-11-12-19-20(15-17)27(39)35(26(19)38)21-13-14-23(36)32-25(21)37/h3-12,15,21H,13-14H2,1-2H3,(H2,31,34,40)(H,32,36,37) |
| InChIKey | LNJSXEMOOMZNDS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 137.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.63 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|