C26H25N5O6S — CID 178049455
1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-3-[2-(6-methoxy-1,3-benzothiazol-2-yl)butan-2-yl]urea (PubChem CID 178049455) has the molecular formula C26H25N5O6S and a molecular weight of 535.58 g/mol. Its IUPAC name is 1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-3-[2-(6-methoxy-1,3-benzothiazol-2-yl)butan-2-yl]urea.
| Compound Name | 1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-3-[2-(6-methoxy-1,3-benzothiazol-2-yl)butan-2-yl]urea |
|---|---|
| PubChem CID | 178049455 |
| Molecular Formula | C26H25N5O6S |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | 1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-3-[2-(6-methoxy-1,3-benzothiazol-2-yl)butan-2-yl]urea |
| SMILES | CCC(C)(NC(=O)Nc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O)c1nc2ccc(OC)cc2s1 |
| InChI | InChI=1S/C26H25N5O6S/c1-4-26(2,24-28-17-8-6-14(37-3)12-19(17)38-24)30-25(36)27-13-5-7-15-16(11-13)23(35)31(22(15)34)18-9-10-20(32)29-21(18)33/h5-8,11-12,18H,4,9-10H2,1-3H3,(H2,27,30,36)(H,29,32,33) |
| InChIKey | FOLYASBQMGDGJT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 146.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|