C34H28N4O7 — CID 168863719
4-[[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]methyl]-N-[2-(4-methoxyphenoxy)phenyl]benzamide (PubChem CID 168863719) has the molecular formula C34H28N4O7 and a molecular weight of 604.62 g/mol. Its IUPAC name is 4-[[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]methyl]-N-[2-(4-methoxyphenoxy)phenyl]benzamide.
| Compound Name | 4-[[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]methyl]-N-[2-(4-methoxyphenoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 168863719 |
| Molecular Formula | C34H28N4O7 |
| Molecular Weight | 604.62 g/mol |
| Exact Mass | 604.20 |
| IUPAC Name | 4-[[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]methyl]-N-[2-(4-methoxyphenoxy)phenyl]benzamide |
| SMILES | COc1ccc(Oc2ccccc2NC(=O)c2ccc(CNc3ccc4c(c3)C(=O)N(C3CCC(=O)NC3=O)C4=O)cc2)cc1 |
| InChI | InChI=1S/C34H28N4O7/c1-44-23-11-13-24(14-12-23)45-29-5-3-2-4-27(29)36-31(40)21-8-6-20(7-9-21)19-35-22-10-15-25-26(18-22)34(43)38(33(25)42)28-16-17-30(39)37-32(28)41/h2-15,18,28,35H,16-17,19H2,1H3,(H,36,40)(H,37,39,41) |
| InChIKey | NCAKXNQOMNERKW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.62 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|