C25H20N6O5S — CID 178049123
1-[6-(2,6-dioxopiperidin-3-yl)-5,7-dioxopyrrolo[3,4-b]pyridin-2-yl]-3-[2-(4-ethynyl-1,3-benzothiazol-2-yl)propan-2-yl]urea (PubChem CID 178049123) has the molecular formula C25H20N6O5S and a molecular weight of 516.54 g/mol. Its IUPAC name is 1-[6-(2,6-dioxopiperidin-3-yl)-5,7-dioxopyrrolo[3,4-b]pyridin-2-yl]-3-[2-(4-ethynyl-1,3-benzothiazol-2-yl)propan-2-yl]urea.
| Compound Name | 1-[6-(2,6-dioxopiperidin-3-yl)-5,7-dioxopyrrolo[3,4-b]pyridin-2-yl]-3-[2-(4-ethynyl-1,3-benzothiazol-2-yl)propan-2-yl]urea |
|---|---|
| PubChem CID | 178049123 |
| Molecular Formula | C25H20N6O5S |
| Molecular Weight | 516.54 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | 1-[6-(2,6-dioxopiperidin-3-yl)-5,7-dioxopyrrolo[3,4-b]pyridin-2-yl]-3-[2-(4-ethynyl-1,3-benzothiazol-2-yl)propan-2-yl]urea |
| SMILES | C#Cc1cccc2sc(C(C)(C)NC(=O)Nc3ccc4c(n3)C(=O)N(C3CCC(=O)NC3=O)C4=O)nc12 |
| InChI | InChI=1S/C25H20N6O5S/c1-4-12-6-5-7-15-18(12)29-23(37-15)25(2,3)30-24(36)27-16-10-8-13-19(26-16)22(35)31(21(13)34)14-9-11-17(32)28-20(14)33/h1,5-8,10,14H,9,11H2,2-3H3,(H,28,32,33)(H2,26,27,30,36) |
| InChIKey | GFKYHWNFPXLVAC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 150.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.54 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|