C22H19Cl2FN7O4S+ — CID 178049191
1-[2-(4,6-dichloro-5-fluoro-1,3-benzothiazol-2-yl)propan-2-yl]-3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-pyrazolo[4,3-b]pyridin-1-ium-5-yl]urea (PubChem CID 178049191) has the molecular formula C22H19Cl2FN7O4S+ and a molecular weight of 567.41 g/mol. Its IUPAC name is 1-[2-(4,6-dichloro-5-fluoro-1,3-benzothiazol-2-yl)propan-2-yl]-3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-pyrazolo[4,3-b]pyridin-1-ium-5-yl]urea.
| Compound Name | 1-[2-(4,6-dichloro-5-fluoro-1,3-benzothiazol-2-yl)propan-2-yl]-3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-pyrazolo[4,3-b]pyridin-1-ium-5-yl]urea |
|---|---|
| PubChem CID | 178049191 |
| Molecular Formula | C22H19Cl2FN7O4S+ |
| Molecular Weight | 567.41 g/mol |
| Exact Mass | 566.06 |
| IUPAC Name | 1-[2-(4,6-dichloro-5-fluoro-1,3-benzothiazol-2-yl)propan-2-yl]-3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-pyrazolo[4,3-b]pyridin-1-ium-5-yl]urea |
| SMILES | CC(C)(NC(=O)Nc1ccc2c(n1)CN(C1CCC(=O)NC1=O)[N+]2=O)c1nc2c(Cl)c(F)c(Cl)cc2s1 |
| InChI | InChI=1S/C22H18Cl2FN7O4S/c1-22(2,20-29-18-13(37-20)7-9(23)17(25)16(18)24)30-21(35)27-14-5-3-11-10(26-14)8-31(32(11)36)12-4-6-15(33)28-19(12)34/h3,5,7,12H,4,6,8H2,1-2H3,(H2-,26,27,28,30,33,34,35,36)/p+1 |
| InChIKey | BHJATJOQKZGAFJ-UHFFFAOYSA-O |
| XLogP | 4.14 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|