C28H25N7O4 — CID 176565014
1-[2-[5-(3-cyanophenyl)pyrazin-2-yl]propan-2-yl]-3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]urea (PubChem CID 176565014) has the molecular formula C28H25N7O4 and a molecular weight of 523.55 g/mol. Its IUPAC name is 1-[2-[5-(3-cyanophenyl)pyrazin-2-yl]propan-2-yl]-3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]urea.
| Compound Name | 1-[2-[5-(3-cyanophenyl)pyrazin-2-yl]propan-2-yl]-3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]urea |
|---|---|
| PubChem CID | 176565014 |
| Molecular Formula | C28H25N7O4 |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | 1-[2-[5-(3-cyanophenyl)pyrazin-2-yl]propan-2-yl]-3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]urea |
| SMILES | CC(C)(NC(=O)Nc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O)c1cnc(-c2cccc(C#N)c2)cn1 |
| InChI | InChI=1S/C28H25N7O4/c1-28(2,23-14-30-21(13-31-23)17-5-3-4-16(10-17)12-29)34-27(39)32-19-6-7-20-18(11-19)15-35(26(20)38)22-8-9-24(36)33-25(22)37/h3-7,10-11,13-14,22H,8-9,15H2,1-2H3,(H2,32,34,39)(H,33,36,37) |
| InChIKey | LJTWDGUAGLLJIY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|