C23H18FN5O4 — CID 177187864
N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-(4-fluorophenyl)-1H-pyrazole-5-carboxamide (PubChem CID 177187864) has the molecular formula C23H18FN5O4 and a molecular weight of 447.43 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-(4-fluorophenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-(4-fluorophenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 177187864 |
| Molecular Formula | C23H18FN5O4 |
| Molecular Weight | 447.43 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-(4-fluorophenyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C1CCC(N2Cc3cc(NC(=O)c4cc(-c5ccc(F)cc5)n[nH]4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H18FN5O4/c24-14-3-1-12(2-4-14)17-10-18(28-27-17)21(31)25-15-5-6-16-13(9-15)11-29(23(16)33)19-7-8-20(30)26-22(19)32/h1-6,9-10,19H,7-8,11H2,(H,25,31)(H,27,28)(H,26,30,32) |
| InChIKey | QZBJUPSLFOZQOR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|