C26H25N7O4 — CID 176565134
1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-[2-(5-pyridin-3-ylpyrazin-2-yl)propan-2-yl]urea (PubChem CID 176565134) has the molecular formula C26H25N7O4 and a molecular weight of 499.53 g/mol. Its IUPAC name is 1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-[2-(5-pyridin-3-ylpyrazin-2-yl)propan-2-yl]urea.
| Compound Name | 1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-[2-(5-pyridin-3-ylpyrazin-2-yl)propan-2-yl]urea |
|---|---|
| PubChem CID | 176565134 |
| Molecular Formula | C26H25N7O4 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-[2-(5-pyridin-3-ylpyrazin-2-yl)propan-2-yl]urea |
| SMILES | CC(C)(NC(=O)Nc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O)c1cnc(-c2cccnc2)cn1 |
| InChI | InChI=1S/C26H25N7O4/c1-26(2,21-13-28-19(12-29-21)15-4-3-9-27-11-15)32-25(37)30-17-5-6-18-16(10-17)14-33(24(18)36)20-7-8-22(34)31-23(20)35/h3-6,9-13,20H,7-8,14H2,1-2H3,(H2,30,32,37)(H,31,34,35) |
| InChIKey | WXQWJBBIZZUMID-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 146.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|