C31H34N6O8 — CID 156528355
4-N-[2-[2-[2-(aminomethoxy)ethoxy]ethoxy]ethyl]-2-N-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]quinoline-2,4-dicarboxamide (PubChem CID 156528355) has the molecular formula C31H34N6O8 and a molecular weight of 618.65 g/mol. Its IUPAC name is 4-N-[2-[2-[2-(aminomethoxy)ethoxy]ethoxy]ethyl]-2-N-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]quinoline-2,4-dicarboxamide.
| Compound Name | 4-N-[2-[2-[2-(aminomethoxy)ethoxy]ethoxy]ethyl]-2-N-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]quinoline-2,4-dicarboxamide |
|---|---|
| PubChem CID | 156528355 |
| Molecular Formula | C31H34N6O8 |
| Molecular Weight | 618.65 g/mol |
| Exact Mass | 618.24 |
| IUPAC Name | 4-N-[2-[2-[2-(aminomethoxy)ethoxy]ethoxy]ethyl]-2-N-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]quinoline-2,4-dicarboxamide |
| SMILES | NCOCCOCCOCCNC(=O)c1cc(C(=O)Nc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)nc2ccccc12 |
| InChI | InChI=1S/C31H34N6O8/c32-18-45-14-13-44-12-11-43-10-9-33-28(39)23-16-25(35-24-4-2-1-3-21(23)24)29(40)34-20-6-5-19-17-37(31(42)22(19)15-20)26-7-8-27(38)36-30(26)41/h1-6,15-16,26H,7-14,17-18,32H2,(H,33,39)(H,34,40)(H,36,38,41) |
| InChIKey | DHOCQKCHTRNJBP-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 191.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.65 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|