C24H32N4O5 — CID 162470367
tert-butyl 2-[[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]amino]methyl]piperidine-1-carboxylate (PubChem CID 162470367) has the molecular formula C24H32N4O5 and a molecular weight of 456.54 g/mol. Its IUPAC name is tert-butyl 2-[[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 162470367 |
| Molecular Formula | C24H32N4O5 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | tert-butyl 2-[[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]amino]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1CNc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C24H32N4O5/c1-24(2,3)33-23(32)27-11-5-4-6-17(27)13-25-16-7-8-18-15(12-16)14-28(22(18)31)19-9-10-20(29)26-21(19)30/h7-8,12,17,19,25H,4-6,9-11,13-14H2,1-3H3,(H,26,29,30) |
| InChIKey | PMTVHJFDOSLNTG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|