C27H35F2N3O3 — CID 169190956
N-cyclohexyl-2,2-difluorospiro[3.3]heptan-6-amine;3-(6-methyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (PubChem CID 169190956) has the molecular formula C27H35F2N3O3 and a molecular weight of 487.59 g/mol. Its IUPAC name is N-cyclohexyl-2,2-difluorospiro[3.3]heptan-6-amine;3-(6-methyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione.
| Compound Name | N-cyclohexyl-2,2-difluorospiro[3.3]heptan-6-amine;3-(6-methyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 169190956 |
| Molecular Formula | C27H35F2N3O3 |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | N-cyclohexyl-2,2-difluorospiro[3.3]heptan-6-amine;3-(6-methyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| SMILES | Cc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O.FC1(F)CC2(CC(NC3CCCCC3)C2)C1 |
| InChI | InChI=1S/C14H14N2O3.C13H21F2N/c1-8-2-3-10-9(6-8)7-16(14(10)19)11-4-5-12(17)15-13(11)18;14-13(15)8-12(9-13)6-11(7-12)16-10-4-2-1-3-5-10/h2-3,6,11H,4-5,7H2,1H3,(H,15,17,18);10-11,16H,1-9H2 |
| InChIKey | RVSXAHCPCHLCQG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|