C28H35F2N3O3 — CID 169067999
3-[6-[[(1R,2S)-2-[(2,2-difluorospiro[2.5]octan-6-yl)amino]cyclohexyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169067999) has the molecular formula C28H35F2N3O3 and a molecular weight of 499.60 g/mol. Its IUPAC name is 3-[6-[[(1R,2S)-2-[(2,2-difluorospiro[2.5]octan-6-yl)amino]cyclohexyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[(1R,2S)-2-[(2,2-difluorospiro[2.5]octan-6-yl)amino]cyclohexyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169067999 |
| Molecular Formula | C28H35F2N3O3 |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | 3-[6-[[(1R,2S)-2-[(2,2-difluorospiro[2.5]octan-6-yl)amino]cyclohexyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(C[C@H]4CCCC[C@@H]4NC4CCC5(CC4)CC5(F)F)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H35F2N3O3/c29-28(30)16-27(28)11-9-20(10-12-27)31-22-4-2-1-3-18(22)13-17-5-6-21-19(14-17)15-33(26(21)36)23-7-8-24(34)32-25(23)35/h5-6,14,18,20,22-23,31H,1-4,7-13,15-16H2,(H,32,34,35)/t18-,20?,22+,23?,27?/m1/s1 |
| InChIKey | GCTIQQAJRSVLGD-NDRLJUIVSA-N |
| XLogP | 4.11 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|