C26H35N3O4 — CID 169190883
3-[6-[[(1R,2S)-2-[[(3S)-2,2-dimethyloxolan-3-yl]amino]cyclohexyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169190883) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is 3-[6-[[(1R,2S)-2-[[(3S)-2,2-dimethyloxolan-3-yl]amino]cyclohexyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[(1R,2S)-2-[[(3S)-2,2-dimethyloxolan-3-yl]amino]cyclohexyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169190883 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | 3-[6-[[(1R,2S)-2-[[(3S)-2,2-dimethyloxolan-3-yl]amino]cyclohexyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC1(C)OCC[C@@H]1N[C@H]1CCCC[C@@H]1Cc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C26H35N3O4/c1-26(2)22(11-12-33-26)27-20-6-4-3-5-17(20)13-16-7-8-19-18(14-16)15-29(25(19)32)21-9-10-23(30)28-24(21)31/h7-8,14,17,20-22,27H,3-6,9-13,15H2,1-2H3,(H,28,30,31)/t17-,20+,21?,22+/m1/s1 |
| InChIKey | UWHNHZJPNMIPBJ-UGYVGDFNSA-N |
| XLogP | 2.71 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|