C24H31N3O4 — CID 169067788
3-[3-oxo-6-[[(1R,2S)-2-(oxolan-3-ylamino)cyclohexyl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169067788) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is 3-[3-oxo-6-[[(1R,2S)-2-(oxolan-3-ylamino)cyclohexyl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[[(1R,2S)-2-(oxolan-3-ylamino)cyclohexyl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169067788 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 3-[3-oxo-6-[[(1R,2S)-2-(oxolan-3-ylamino)cyclohexyl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(C[C@H]4CCCC[C@@H]4NC4CCOC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H31N3O4/c28-22-8-7-21(23(29)26-22)27-13-17-12-15(5-6-19(17)24(27)30)11-16-3-1-2-4-20(16)25-18-9-10-31-14-18/h5-6,12,16,18,20-21,25H,1-4,7-11,13-14H2,(H,26,28,29)/t16-,18?,20+,21?/m1/s1 |
| InChIKey | NXMXCWYSZXMVRP-YEGQGQEUSA-N |
| XLogP | 1.93 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|