C26H34IN3O3 — CID 170227411
3-[6-[[(1R,2S)-2-[(4-iodocyclohexyl)amino]cyclohexyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 170227411) has the molecular formula C26H34IN3O3 and a molecular weight of 563.48 g/mol. Its IUPAC name is 3-[6-[[(1R,2S)-2-[(4-iodocyclohexyl)amino]cyclohexyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[(1R,2S)-2-[(4-iodocyclohexyl)amino]cyclohexyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170227411 |
| Molecular Formula | C26H34IN3O3 |
| Molecular Weight | 563.48 g/mol |
| Exact Mass | 563.16 |
| IUPAC Name | 3-[6-[[(1R,2S)-2-[(4-iodocyclohexyl)amino]cyclohexyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(C[C@H]4CCCC[C@@H]4NC4CCC(I)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H34IN3O3/c27-19-6-8-20(9-7-19)28-22-4-2-1-3-17(22)13-16-5-10-21-18(14-16)15-30(26(21)33)23-11-12-24(31)29-25(23)32/h5,10,14,17,19-20,22-23,28H,1-4,6-9,11-13,15H2,(H,29,31,32)/t17-,19?,20?,22+,23?/m1/s1 |
| InChIKey | RATDCTHHEDGNTE-SHOXYREESA-N |
| XLogP | 3.88 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|