C27H31N3O3 — CID 169068132
3-[6-[[(1R,2S)-2-[[dideuterio(phenyl)methyl]amino]cyclohexyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169068132) has the molecular formula C27H31N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is 3-[6-[[(1R,2S)-2-[[dideuterio(phenyl)methyl]amino]cyclohexyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[(1R,2S)-2-[[dideuterio(phenyl)methyl]amino]cyclohexyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169068132 |
| Molecular Formula | C27H31N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 3-[6-[[(1R,2S)-2-[[dideuterio(phenyl)methyl]amino]cyclohexyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | [2H]C([2H])(N[C@H]1CCCC[C@@H]1Cc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O)c1ccccc1 |
| InChI | InChI=1S/C27H31N3O3/c31-25-13-12-24(26(32)29-25)30-17-21-15-19(10-11-22(21)27(30)33)14-20-8-4-5-9-23(20)28-16-18-6-2-1-3-7-18/h1-3,6-7,10-11,15,20,23-24,28H,4-5,8-9,12-14,16-17H2,(H,29,31,32)/t20-,23+,24?/m1/s1/i16D2 |
| InChIKey | RZCSOBHIQDJSEV-ZVQCNREISA-N |
| XLogP | 3.34 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|