C33H37F2N3O3 — CID 170211254
3-[6-[[(1R,2S)-2-[[(4R)-2,2-difluoro-4-methyl-3-phenyl-1-bicyclo[1.1.1]pentanyl]methylamino]cyclohexyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 170211254) has the molecular formula C33H37F2N3O3 and a molecular weight of 561.67 g/mol. Its IUPAC name is 3-[6-[[(1R,2S)-2-[[(4R)-2,2-difluoro-4-methyl-3-phenyl-1-bicyclo[1.1.1]pentanyl]methylamino]cyclohexyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[(1R,2S)-2-[[(4R)-2,2-difluoro-4-methyl-3-phenyl-1-bicyclo[1.1.1]pentanyl]methylamino]cyclohexyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170211254 |
| Molecular Formula | C33H37F2N3O3 |
| Molecular Weight | 561.67 g/mol |
| Exact Mass | 561.28 |
| IUPAC Name | 3-[6-[[(1R,2S)-2-[[(4R)-2,2-difluoro-4-methyl-3-phenyl-1-bicyclo[1.1.1]pentanyl]methylamino]cyclohexyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | C[C@H]1C2(CN[C@H]3CCCC[C@@H]3Cc3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)CC1(c1ccccc1)C2(F)F |
| InChI | InChI=1S/C33H37F2N3O3/c1-20-31(18-32(20,33(31,34)35)24-8-3-2-4-9-24)19-36-26-10-6-5-7-22(26)15-21-11-12-25-23(16-21)17-38(30(25)41)27-13-14-28(39)37-29(27)40/h2-4,8-9,11-12,16,20,22,26-27,36H,5-7,10,13-15,17-19H2,1H3,(H,37,39,40)/t20-,22+,26-,27?,31?,32?/m0/s1 |
| InChIKey | AOKZQNBFNCNRRH-HLQOYNJPSA-N |
| XLogP | 4.75 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.67 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|