C28H37N3O4 — CID 170227172
3-[6-[[(1R,2S)-2-(3-oxabicyclo[4.2.1]nonan-8-ylamino)cyclohexyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 170227172) has the molecular formula C28H37N3O4 and a molecular weight of 479.62 g/mol. Its IUPAC name is 3-[6-[[(1R,2S)-2-(3-oxabicyclo[4.2.1]nonan-8-ylamino)cyclohexyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[(1R,2S)-2-(3-oxabicyclo[4.2.1]nonan-8-ylamino)cyclohexyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170227172 |
| Molecular Formula | C28H37N3O4 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | 3-[6-[[(1R,2S)-2-(3-oxabicyclo[4.2.1]nonan-8-ylamino)cyclohexyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(C[C@H]4CCCC[C@@H]4NC4CC5CCOCC4C5)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H37N3O4/c32-26-8-7-25(27(33)30-26)31-15-20-12-17(5-6-22(20)28(31)34)11-19-3-1-2-4-23(19)29-24-14-18-9-10-35-16-21(24)13-18/h5-6,12,18-19,21,23-25,29H,1-4,7-11,13-16H2,(H,30,32,33)/t18?,19-,21?,23+,24?,25?/m1/s1 |
| InChIKey | FFANHIDGKRDJHP-AXZJGPOBSA-N |
| XLogP | 2.95 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|