C26H32FN3O3 — CID 169067762
3-[6-[[(1S,6S)-6-(cyclohexylamino)-3-fluorocyclohex-2-en-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169067762) has the molecular formula C26H32FN3O3 and a molecular weight of 453.56 g/mol. Its IUPAC name is 3-[6-[[(1S,6S)-6-(cyclohexylamino)-3-fluorocyclohex-2-en-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[(1S,6S)-6-(cyclohexylamino)-3-fluorocyclohex-2-en-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169067762 |
| Molecular Formula | C26H32FN3O3 |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 3-[6-[[(1S,6S)-6-(cyclohexylamino)-3-fluorocyclohex-2-en-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(C[C@H]4C=C(F)CC[C@@H]4NC4CCCCC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H32FN3O3/c27-19-7-9-22(28-20-4-2-1-3-5-20)17(14-19)12-16-6-8-21-18(13-16)15-30(26(21)33)23-10-11-24(31)29-25(23)32/h6,8,13-14,17,20,22-23,28H,1-5,7,9-12,15H2,(H,29,31,32)/t17-,22-,23?/m0/s1 |
| InChIKey | XXCHMUOTSUBJNR-QPTFRZOZSA-N |
| XLogP | 3.54 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|