C26H32F3N3O4 — CID 169080913
3-[3-oxo-6-[[(2R,3S)-3-[[4-(trifluoromethyl)cyclohexyl]amino]oxan-2-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169080913) has the molecular formula C26H32F3N3O4 and a molecular weight of 507.55 g/mol. Its IUPAC name is 3-[3-oxo-6-[[(2R,3S)-3-[[4-(trifluoromethyl)cyclohexyl]amino]oxan-2-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[[(2R,3S)-3-[[4-(trifluoromethyl)cyclohexyl]amino]oxan-2-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169080913 |
| Molecular Formula | C26H32F3N3O4 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | 3-[3-oxo-6-[[(2R,3S)-3-[[4-(trifluoromethyl)cyclohexyl]amino]oxan-2-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(C[C@H]4OCCC[C@@H]4NC4CCC(C(F)(F)F)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H32F3N3O4/c27-26(28,29)17-4-6-18(7-5-17)30-20-2-1-11-36-22(20)13-15-3-8-19-16(12-15)14-32(25(19)35)21-9-10-23(33)31-24(21)34/h3,8,12,17-18,20-22,30H,1-2,4-7,9-11,13-14H2,(H,31,33,34)/t17?,18?,20-,21?,22+/m0/s1 |
| InChIKey | AIMKOFBUFCPEJD-ZQUXGKCXSA-N |
| XLogP | 3.25 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|