C24H34FN3O3 — CID 169190602
N-butan-2-ylcyclohexanamine;3-(7-fluoro-6-methyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (PubChem CID 169190602) has the molecular formula C24H34FN3O3 and a molecular weight of 431.55 g/mol. Its IUPAC name is N-butan-2-ylcyclohexanamine;3-(7-fluoro-6-methyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione.
| Compound Name | N-butan-2-ylcyclohexanamine;3-(7-fluoro-6-methyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 169190602 |
| Molecular Formula | C24H34FN3O3 |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | N-butan-2-ylcyclohexanamine;3-(7-fluoro-6-methyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| SMILES | CCC(C)NC1CCCCC1.Cc1ccc2c(c1F)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C14H13FN2O3.C10H21N/c1-7-2-3-8-9(12(7)15)6-17(14(8)20)10-4-5-11(18)16-13(10)19;1-3-9(2)11-10-7-5-4-6-8-10/h2-3,10H,4-6H2,1H3,(H,16,18,19);9-11H,3-8H2,1-2H3 |
| InChIKey | BBUILBMHSXKAEE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|