C25H32FN3O4 — CID 177017638
3-[6-(2-ethyl-5-hydroxy-2-azaspiro[5.5]undecan-5-yl)-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 177017638) has the molecular formula C25H32FN3O4 and a molecular weight of 457.55 g/mol. Its IUPAC name is 3-[6-(2-ethyl-5-hydroxy-2-azaspiro[5.5]undecan-5-yl)-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-(2-ethyl-5-hydroxy-2-azaspiro[5.5]undecan-5-yl)-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177017638 |
| Molecular Formula | C25H32FN3O4 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 3-[6-(2-ethyl-5-hydroxy-2-azaspiro[5.5]undecan-5-yl)-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCN1CCC(O)(c2ccc3c(c2F)CN(C2CCC(=O)NC2=O)C3=O)C2(CCCCC2)C1 |
| InChI | InChI=1S/C25H32FN3O4/c1-2-28-13-12-25(33,24(15-28)10-4-3-5-11-24)18-7-6-16-17(21(18)26)14-29(23(16)32)19-8-9-20(30)27-22(19)31/h6-7,19,33H,2-5,8-15H2,1H3,(H,27,30,31) |
| InChIKey | BEDIWFFUTMYWAV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|