C23H28FN3O4 — CID 177018246
(3S)-3-[(2R)-5,7-diethyl-16-fluoro-2-hydroxy-12-oxo-5,13-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),9,11(15)-trien-13-yl]piperidine-2,6-dione (PubChem CID 177018246) has the molecular formula C23H28FN3O4 and a molecular weight of 429.49 g/mol. Its IUPAC name is (3S)-3-[(2R)-5,7-diethyl-16-fluoro-2-hydroxy-12-oxo-5,13-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),9,11(15)-trien-13-yl]piperidine-2,6-dione.
| Compound Name | (3S)-3-[(2R)-5,7-diethyl-16-fluoro-2-hydroxy-12-oxo-5,13-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),9,11(15)-trien-13-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177018246 |
| Molecular Formula | C23H28FN3O4 |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | (3S)-3-[(2R)-5,7-diethyl-16-fluoro-2-hydroxy-12-oxo-5,13-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),9,11(15)-trien-13-yl]piperidine-2,6-dione |
| SMILES | CCN1CC[C@]2(O)c3c(cc4c(c3F)CN([C@H]3CCC(=O)NC3=O)C4=O)CC2(CC)C1 |
| InChI | InChI=1S/C23H28FN3O4/c1-3-22-10-13-9-14-15(11-27(21(14)30)16-5-6-17(28)25-20(16)29)19(24)18(13)23(22,31)7-8-26(4-2)12-22/h9,16,31H,3-8,10-12H2,1-2H3,(H,25,28,29)/t16-,22?,23-/m0/s1 |
| InChIKey | KNALTTXSGOEOMQ-GDTQQENISA-N |
| XLogP | 1.45 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|