C31H35N3O5 — CID 177018197
3-[13-[(4-cyclopropyloxyphenyl)methyl]-15-ethyl-10-hydroxy-5-oxo-4,13-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),7-trien-4-yl]piperidine-2,6-dione (PubChem CID 177018197) has the molecular formula C31H35N3O5 and a molecular weight of 529.64 g/mol. Its IUPAC name is 3-[13-[(4-cyclopropyloxyphenyl)methyl]-15-ethyl-10-hydroxy-5-oxo-4,13-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),7-trien-4-yl]piperidine-2,6-dione.
| Compound Name | 3-[13-[(4-cyclopropyloxyphenyl)methyl]-15-ethyl-10-hydroxy-5-oxo-4,13-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),7-trien-4-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177018197 |
| Molecular Formula | C31H35N3O5 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | 3-[13-[(4-cyclopropyloxyphenyl)methyl]-15-ethyl-10-hydroxy-5-oxo-4,13-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),7-trien-4-yl]piperidine-2,6-dione |
| SMILES | CCC12Cc3c(ccc4c3CN(C3CCC(=O)NC3=O)C4=O)C1(O)CCN(Cc1ccc(OC3CC3)cc1)C2 |
| InChI | InChI=1S/C31H35N3O5/c1-2-30-15-23-24-17-34(26-11-12-27(35)32-28(26)36)29(37)22(24)9-10-25(23)31(30,38)13-14-33(18-30)16-19-3-5-20(6-4-19)39-21-7-8-21/h3-6,9-10,21,26,38H,2,7-8,11-18H2,1H3,(H,32,35,36) |
| InChIKey | HFPMMFPFOXVOMM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|