C26H26F3N3O5 — CID 177017756
3-[6-(1-benzyl-4-hydroxypiperidin-4-yl)-3-oxo-7-(trifluoromethoxy)-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 177017756) has the molecular formula C26H26F3N3O5 and a molecular weight of 517.50 g/mol. Its IUPAC name is 3-[6-(1-benzyl-4-hydroxypiperidin-4-yl)-3-oxo-7-(trifluoromethoxy)-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-(1-benzyl-4-hydroxypiperidin-4-yl)-3-oxo-7-(trifluoromethoxy)-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177017756 |
| Molecular Formula | C26H26F3N3O5 |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | 3-[6-(1-benzyl-4-hydroxypiperidin-4-yl)-3-oxo-7-(trifluoromethoxy)-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(ccc(C4(O)CCN(Cc5ccccc5)CC4)c3OC(F)(F)F)C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H26F3N3O5/c27-26(28,29)37-22-18-15-32(20-8-9-21(33)30-23(20)34)24(35)17(18)6-7-19(22)25(36)10-12-31(13-11-25)14-16-4-2-1-3-5-16/h1-7,20,36H,8-15H2,(H,30,33,34) |
| InChIKey | IYCJDOGFSCEROF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|