C27H28N4O4 — CID 177017709
4-[[4-[2-(2,6-dioxopiperidin-3-yl)-4-methyl-1-oxo-3H-isoindol-5-yl]-4-hydroxypiperidin-1-yl]methyl]benzonitrile (PubChem CID 177017709) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is 4-[[4-[2-(2,6-dioxopiperidin-3-yl)-4-methyl-1-oxo-3H-isoindol-5-yl]-4-hydroxypiperidin-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-[2-(2,6-dioxopiperidin-3-yl)-4-methyl-1-oxo-3H-isoindol-5-yl]-4-hydroxypiperidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 177017709 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 4-[[4-[2-(2,6-dioxopiperidin-3-yl)-4-methyl-1-oxo-3H-isoindol-5-yl]-4-hydroxypiperidin-1-yl]methyl]benzonitrile |
| SMILES | Cc1c(C2(O)CCN(Cc3ccc(C#N)cc3)CC2)ccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C27H28N4O4/c1-17-21-16-31(23-8-9-24(32)29-25(23)33)26(34)20(21)6-7-22(17)27(35)10-12-30(13-11-27)15-19-4-2-18(14-28)3-5-19/h2-7,23,35H,8-13,15-16H2,1H3,(H,29,32,33) |
| InChIKey | AGKDOVZWWFKAKB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|