C28H29F2N3O4 — CID 170278911
3-[1'-[[4-(1,1-difluoroethyl)phenyl]methyl]-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione (PubChem CID 170278911) has the molecular formula C28H29F2N3O4 and a molecular weight of 509.55 g/mol. Its IUPAC name is 3-[1'-[[4-(1,1-difluoroethyl)phenyl]methyl]-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione.
| Compound Name | 3-[1'-[[4-(1,1-difluoroethyl)phenyl]methyl]-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170278911 |
| Molecular Formula | C28H29F2N3O4 |
| Molecular Weight | 509.55 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | 3-[1'-[[4-(1,1-difluoroethyl)phenyl]methyl]-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione |
| SMILES | CC(F)(F)c1ccc(CN2CCC3(CC2)COc2c3ccc3c2CN(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C28H29F2N3O4/c1-27(29,30)18-4-2-17(3-5-18)14-32-12-10-28(11-13-32)16-37-24-20-15-33(22-8-9-23(34)31-25(22)35)26(36)19(20)6-7-21(24)28/h2-7,22H,8-16H2,1H3,(H,31,34,35) |
| InChIKey | RKOSQKFEQGNLOX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|