C26H31F2N3O4 — CID 169201245
3-[1'-[(4,4-difluorocyclohexyl)methyl]-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione (PubChem CID 169201245) has the molecular formula C26H31F2N3O4 and a molecular weight of 487.55 g/mol. Its IUPAC name is 3-[1'-[(4,4-difluorocyclohexyl)methyl]-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione.
| Compound Name | 3-[1'-[(4,4-difluorocyclohexyl)methyl]-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169201245 |
| Molecular Formula | C26H31F2N3O4 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | 3-[1'-[(4,4-difluorocyclohexyl)methyl]-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(ccc4c3OCC43CCN(CC4CCC(F)(F)CC4)CC3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H31F2N3O4/c27-26(28)7-5-16(6-8-26)13-30-11-9-25(10-12-30)15-35-22-18-14-31(20-3-4-21(32)29-23(20)33)24(34)17(18)1-2-19(22)25/h1-2,16,20H,3-15H2,(H,29,32,33) |
| InChIKey | QLHCKMGMZFTRSB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|