C29H30FN3O4 — CID 169201474
(3S)-3-[1'-[[(1R,2R)-2-(4-fluorophenyl)cyclopropyl]methyl]-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione (PubChem CID 169201474) has the molecular formula C29H30FN3O4 and a molecular weight of 503.57 g/mol. Its IUPAC name is (3S)-3-[1'-[[(1R,2R)-2-(4-fluorophenyl)cyclopropyl]methyl]-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione.
| Compound Name | (3S)-3-[1'-[[(1R,2R)-2-(4-fluorophenyl)cyclopropyl]methyl]-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169201474 |
| Molecular Formula | C29H30FN3O4 |
| Molecular Weight | 503.57 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | (3S)-3-[1'-[[(1R,2R)-2-(4-fluorophenyl)cyclopropyl]methyl]-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione |
| SMILES | O=C1CC[C@H](N2Cc3c(ccc4c3OCC43CCN(C[C@@H]4C[C@H]4c4ccc(F)cc4)CC3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C29H30FN3O4/c30-19-3-1-17(2-4-19)21-13-18(21)14-32-11-9-29(10-12-32)16-37-26-22-15-33(24-7-8-25(34)31-27(24)35)28(36)20(22)5-6-23(26)29/h1-6,18,21,24H,7-16H2,(H,31,34,35)/t18-,21-,24-/m0/s1 |
| InChIKey | QATDFGGEPURLHB-XZOYJPPVSA-N |
| XLogP | 3.12 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.57 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|