C27H29N5O4 — CID 169201359
3-[1'-[2-(2-aminophenyl)-2-iminoethyl]-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione (PubChem CID 169201359) has the molecular formula C27H29N5O4 and a molecular weight of 487.56 g/mol. Its IUPAC name is 3-[1'-[2-(2-aminophenyl)-2-iminoethyl]-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione.
| Compound Name | 3-[1'-[2-(2-aminophenyl)-2-iminoethyl]-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169201359 |
| Molecular Formula | C27H29N5O4 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 3-[1'-[2-(2-aminophenyl)-2-iminoethyl]-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione |
| SMILES | [H]/N=C(/CN1CCC2(CC1)COc1c2ccc2c1CN(C1CCC(=O)NC1=O)C2=O)c1ccccc1N |
| InChI | InChI=1S/C27H29N5O4/c28-20-4-2-1-3-17(20)21(29)14-31-11-9-27(10-12-31)15-36-24-18-13-32(22-7-8-23(33)30-25(22)34)26(35)16(18)5-6-19(24)27/h1-6,22,29H,7-15,28H2,(H,30,33,34)/b29-21- |
| InChIKey | PZIWDLYRKUFWMB-ANYBSYGZSA-N |
| XLogP | 1.82 |
| TPSA | 128.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|