C29H31N3O4 — CID 176808522
3-[6-oxo-1'-[[(1R,2R)-2-phenylcyclopropyl]methyl]spiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione (PubChem CID 176808522) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is 3-[6-oxo-1'-[[(1R,2R)-2-phenylcyclopropyl]methyl]spiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-oxo-1'-[[(1R,2R)-2-phenylcyclopropyl]methyl]spiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176808522 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 3-[6-oxo-1'-[[(1R,2R)-2-phenylcyclopropyl]methyl]spiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(ccc4c3OCC43CCN(C[C@@H]4C[C@H]4c4ccccc4)CC3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C29H31N3O4/c33-25-9-8-24(27(34)30-25)32-16-22-20(28(32)35)6-7-23-26(22)36-17-29(23)10-12-31(13-11-29)15-19-14-21(19)18-4-2-1-3-5-18/h1-7,19,21,24H,8-17H2,(H,30,33,34)/t19-,21-,24?/m0/s1 |
| InChIKey | QEAOYJNOHYNPGH-GGGSXUAESA-N |
| XLogP | 2.98 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|