C28H27N5O4 — CID 169201254
3-[6-oxo-1'-(quinoxalin-6-ylmethyl)spiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione (PubChem CID 169201254) has the molecular formula C28H27N5O4 and a molecular weight of 497.56 g/mol. Its IUPAC name is 3-[6-oxo-1'-(quinoxalin-6-ylmethyl)spiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-oxo-1'-(quinoxalin-6-ylmethyl)spiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169201254 |
| Molecular Formula | C28H27N5O4 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 3-[6-oxo-1'-(quinoxalin-6-ylmethyl)spiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(ccc4c3OCC43CCN(Cc4ccc5nccnc5c4)CC3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H27N5O4/c34-24-6-5-23(26(35)31-24)33-15-19-18(27(33)36)2-3-20-25(19)37-16-28(20)7-11-32(12-8-28)14-17-1-4-21-22(13-17)30-10-9-29-21/h1-4,9-10,13,23H,5-8,11-12,14-16H2,(H,31,34,35) |
| InChIKey | WRFOURLXMVMSKM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|