C33H35FN4O3 — CID 171828947
3-[6-[(4-benzhydryl-3,3-dimethylpiperazin-1-yl)methyl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171828947) has the molecular formula C33H35FN4O3 and a molecular weight of 554.67 g/mol. Its IUPAC name is 3-[6-[(4-benzhydryl-3,3-dimethylpiperazin-1-yl)methyl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(4-benzhydryl-3,3-dimethylpiperazin-1-yl)methyl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171828947 |
| Molecular Formula | C33H35FN4O3 |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | 3-[6-[(4-benzhydryl-3,3-dimethylpiperazin-1-yl)methyl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC1(C)CN(Cc2ccc3c(c2F)CN(C2CCC(=O)NC2=O)C3=O)CCN1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H35FN4O3/c1-33(2)21-36(17-18-38(33)30(22-9-5-3-6-10-22)23-11-7-4-8-12-23)19-24-13-14-25-26(29(24)34)20-37(32(25)41)27-15-16-28(39)35-31(27)40/h3-14,27,30H,15-21H2,1-2H3,(H,35,39,40) |
| InChIKey | JOGDLXAEJHNACO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|