C24H30FN3O6 — CID 176695323
tert-butyl 2-[1-[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]-4-hydroxypiperidin-4-yl]acetate (PubChem CID 176695323) has the molecular formula C24H30FN3O6 and a molecular weight of 475.52 g/mol. Its IUPAC name is tert-butyl 2-[1-[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]-4-hydroxypiperidin-4-yl]acetate.
| Compound Name | tert-butyl 2-[1-[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]-4-hydroxypiperidin-4-yl]acetate |
|---|---|
| PubChem CID | 176695323 |
| Molecular Formula | C24H30FN3O6 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | tert-butyl 2-[1-[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]-4-hydroxypiperidin-4-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1(O)CCN(c2ccc3c(c2F)CN(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C24H30FN3O6/c1-23(2,3)34-19(30)12-24(33)8-10-27(11-9-24)16-5-4-14-15(20(16)25)13-28(22(14)32)17-6-7-18(29)26-21(17)31/h4-5,17,33H,6-13H2,1-3H3,(H,26,29,31) |
| InChIKey | QZZMQURJWYZGBT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|