C24H30F2N4O3 — CID 165137576
3-[7-fluoro-6-[4-[(4-fluoropiperidin-4-yl)methyl]piperidin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 165137576) has the molecular formula C24H30F2N4O3 and a molecular weight of 460.53 g/mol. Its IUPAC name is 3-[7-fluoro-6-[4-[(4-fluoropiperidin-4-yl)methyl]piperidin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-fluoro-6-[4-[(4-fluoropiperidin-4-yl)methyl]piperidin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 165137576 |
| Molecular Formula | C24H30F2N4O3 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 3-[7-fluoro-6-[4-[(4-fluoropiperidin-4-yl)methyl]piperidin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(ccc(N4CCC(CC5(F)CCNCC5)CC4)c3F)C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H30F2N4O3/c25-21-17-14-30(19-3-4-20(31)28-22(19)32)23(33)16(17)1-2-18(21)29-11-5-15(6-12-29)13-24(26)7-9-27-10-8-24/h1-2,15,19,27H,3-14H2,(H,28,31,32) |
| InChIKey | XOUPWSZRXBVFHG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|