C23H27F3N4O3 — CID 171530161
3-[6-[1-(3,3-difluoropiperidin-4-yl)piperidin-4-yl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171530161) has the molecular formula C23H27F3N4O3 and a molecular weight of 464.49 g/mol. Its IUPAC name is 3-[6-[1-(3,3-difluoropiperidin-4-yl)piperidin-4-yl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[1-(3,3-difluoropiperidin-4-yl)piperidin-4-yl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171530161 |
| Molecular Formula | C23H27F3N4O3 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 3-[6-[1-(3,3-difluoropiperidin-4-yl)piperidin-4-yl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(ccc(C4CCN(C5CCNCC5(F)F)CC4)c3F)C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H27F3N4O3/c24-20-14(13-6-9-29(10-7-13)18-5-8-27-12-23(18,25)26)1-2-15-16(20)11-30(22(15)33)17-3-4-19(31)28-21(17)32/h1-2,13,17-18,27H,3-12H2,(H,28,31,32) |
| InChIKey | ALBACRZDIAORPY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|