C23H27F2N3O5 — CID 170650536
tert-butyl 4-[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]-3-fluoropiperidine-1-carboxylate (PubChem CID 170650536) has the molecular formula C23H27F2N3O5 and a molecular weight of 463.48 g/mol. Its IUPAC name is tert-butyl 4-[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]-3-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]-3-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 170650536 |
| Molecular Formula | C23H27F2N3O5 |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | tert-butyl 4-[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]-3-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc3c(c2F)CN(C2CCC(=O)NC2=O)C3=O)C(F)C1 |
| InChI | InChI=1S/C23H27F2N3O5/c1-23(2,3)33-22(32)27-9-8-12(16(24)11-27)13-4-5-14-15(19(13)25)10-28(21(14)31)17-6-7-18(29)26-20(17)30/h4-5,12,16-17H,6-11H2,1-3H3,(H,26,29,30) |
| InChIKey | INZULGMPUUIOJX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|