C28H38N4O5 — CID 172592325
tert-butyl 3-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperidin-1-yl]piperidine-1-carboxylate (PubChem CID 172592325) has the molecular formula C28H38N4O5 and a molecular weight of 510.64 g/mol. Its IUPAC name is tert-butyl 3-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperidin-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperidin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 172592325 |
| Molecular Formula | C28H38N4O5 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | tert-butyl 3-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperidin-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(N2CCC(c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)CC2)C1 |
| InChI | InChI=1S/C28H38N4O5/c1-28(2,3)37-27(36)31-12-4-5-21(17-31)30-13-10-18(11-14-30)19-6-7-22-20(15-19)16-32(26(22)35)23-8-9-24(33)29-25(23)34/h6-7,15,18,21,23H,4-5,8-14,16-17H2,1-3H3,(H,29,33,34) |
| InChIKey | DWBNWHOTHSRSFM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|