C26H34BrN3O4 — CID 164864624
3-[6-[1-(8-bromooctanoyl)piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 164864624) has the molecular formula C26H34BrN3O4 and a molecular weight of 532.48 g/mol. Its IUPAC name is 3-[6-[1-(8-bromooctanoyl)piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[1-(8-bromooctanoyl)piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 164864624 |
| Molecular Formula | C26H34BrN3O4 |
| Molecular Weight | 532.48 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | 3-[6-[1-(8-bromooctanoyl)piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(C4CCN(C(=O)CCCCCCCBr)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H34BrN3O4/c27-13-5-3-1-2-4-6-24(32)29-14-11-18(12-15-29)19-7-8-21-20(16-19)17-30(26(21)34)22-9-10-23(31)28-25(22)33/h7-8,16,18,22H,1-6,9-15,17H2,(H,28,31,33) |
| InChIKey | RAVQYZBTVFXZKK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|