C30H34ClN3O4 — CID 170548206
3-[5-[6-[4-(4-chlorophenyl)piperidin-1-yl]-6-oxohexyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 170548206) has the molecular formula C30H34ClN3O4 and a molecular weight of 536.07 g/mol. Its IUPAC name is 3-[5-[6-[4-(4-chlorophenyl)piperidin-1-yl]-6-oxohexyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[6-[4-(4-chlorophenyl)piperidin-1-yl]-6-oxohexyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170548206 |
| Molecular Formula | C30H34ClN3O4 |
| Molecular Weight | 536.07 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | 3-[5-[6-[4-(4-chlorophenyl)piperidin-1-yl]-6-oxohexyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3ccc(CCCCCC(=O)N4CCC(c5ccc(Cl)cc5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H34ClN3O4/c31-24-10-8-21(9-11-24)22-14-16-33(17-15-22)28(36)5-3-1-2-4-20-6-7-23-19-34(30(38)25(23)18-20)26-12-13-27(35)32-29(26)37/h6-11,18,22,26H,1-5,12-17,19H2,(H,32,35,37) |
| InChIKey | VNOVOFAHGWCDOC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.07 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|