C27H35FN4O4 — CID 166077348
3-[7-fluoro-3-oxo-6-[1-(3-piperidin-4-yloxycyclobutyl)piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166077348) has the molecular formula C27H35FN4O4 and a molecular weight of 498.60 g/mol. Its IUPAC name is 3-[7-fluoro-3-oxo-6-[1-(3-piperidin-4-yloxycyclobutyl)piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-fluoro-3-oxo-6-[1-(3-piperidin-4-yloxycyclobutyl)piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166077348 |
| Molecular Formula | C27H35FN4O4 |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 3-[7-fluoro-3-oxo-6-[1-(3-piperidin-4-yloxycyclobutyl)piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(ccc(C4CCN(C5CC(OC6CCNCC6)C5)CC4)c3F)C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H35FN4O4/c28-25-20(1-2-21-22(25)15-32(27(21)35)23-3-4-24(33)30-26(23)34)16-7-11-31(12-8-16)17-13-19(14-17)36-18-5-9-29-10-6-18/h1-2,16-19,23,29H,3-15H2,(H,30,33,34) |
| InChIKey | AYAWYZQNOPNHGQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|