C28H38FN3O6 — CID 171641747
3-[6-[4-[4-(2,2-dimethoxyethyl)cyclohexyl]oxypiperidin-1-yl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171641747) has the molecular formula C28H38FN3O6 and a molecular weight of 531.63 g/mol. Its IUPAC name is 3-[6-[4-[4-(2,2-dimethoxyethyl)cyclohexyl]oxypiperidin-1-yl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[4-(2,2-dimethoxyethyl)cyclohexyl]oxypiperidin-1-yl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171641747 |
| Molecular Formula | C28H38FN3O6 |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | 3-[6-[4-[4-(2,2-dimethoxyethyl)cyclohexyl]oxypiperidin-1-yl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | COC(CC1CCC(OC2CCN(c3ccc4c(c3F)CN(C3CCC(=O)NC3=O)C4=O)CC2)CC1)OC |
| InChI | InChI=1S/C28H38FN3O6/c1-36-25(37-2)15-17-3-5-18(6-4-17)38-19-11-13-31(14-12-19)22-8-7-20-21(26(22)29)16-32(28(20)35)23-9-10-24(33)30-27(23)34/h7-8,17-19,23,25H,3-6,9-16H2,1-2H3,(H,30,33,34) |
| InChIKey | VRXFRZIDPVJGCB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|