C22H27FN4O3 — CID 171847110
3-[6-(4-cyclobutyl-3-methylpiperazin-1-yl)-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171847110) has the molecular formula C22H27FN4O3 and a molecular weight of 414.48 g/mol. Its IUPAC name is 3-[6-(4-cyclobutyl-3-methylpiperazin-1-yl)-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-(4-cyclobutyl-3-methylpiperazin-1-yl)-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171847110 |
| Molecular Formula | C22H27FN4O3 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 3-[6-(4-cyclobutyl-3-methylpiperazin-1-yl)-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC1CN(c2ccc3c(c2F)CN(C2CCC(=O)NC2=O)C3=O)CCN1C1CCC1 |
| InChI | InChI=1S/C22H27FN4O3/c1-13-11-25(9-10-26(13)14-3-2-4-14)17-6-5-15-16(20(17)23)12-27(22(15)30)18-7-8-19(28)24-21(18)29/h5-6,13-14,18H,2-4,7-12H2,1H3,(H,24,28,29) |
| InChIKey | YBLCYWBZZPYKET-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|