C19H24FN3O4 — CID 169190637
3-(7-fluoro-6-methyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;oxan-3-amine (PubChem CID 169190637) has the molecular formula C19H24FN3O4 and a molecular weight of 377.42 g/mol. Its IUPAC name is 3-(7-fluoro-6-methyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;oxan-3-amine.
| Compound Name | 3-(7-fluoro-6-methyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;oxan-3-amine |
|---|---|
| PubChem CID | 169190637 |
| Molecular Formula | C19H24FN3O4 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 3-(7-fluoro-6-methyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;oxan-3-amine |
| SMILES | Cc1ccc2c(c1F)CN(C1CCC(=O)NC1=O)C2=O.NC1CCCOC1 |
| InChI | InChI=1S/C14H13FN2O3.C5H11NO/c1-7-2-3-8-9(12(7)15)6-17(14(8)20)10-4-5-11(18)16-13(10)19;6-5-2-1-3-7-4-5/h2-3,10H,4-6H2,1H3,(H,16,18,19);5H,1-4,6H2 |
| InChIKey | DOTNIQJIJMABRR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|