C26H36FN3O3 — CID 169067855
3-[6-[[(1R,2S)-2-(3,3-dimethylbutylamino)cyclohexyl]methyl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169067855) has the molecular formula C26H36FN3O3 and a molecular weight of 457.59 g/mol. Its IUPAC name is 3-[6-[[(1R,2S)-2-(3,3-dimethylbutylamino)cyclohexyl]methyl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[(1R,2S)-2-(3,3-dimethylbutylamino)cyclohexyl]methyl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169067855 |
| Molecular Formula | C26H36FN3O3 |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | 3-[6-[[(1R,2S)-2-(3,3-dimethylbutylamino)cyclohexyl]methyl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC(C)(C)CCN[C@H]1CCCC[C@@H]1Cc1ccc2c(c1F)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C26H36FN3O3/c1-26(2,3)12-13-28-20-7-5-4-6-16(20)14-17-8-9-18-19(23(17)27)15-30(25(18)33)21-10-11-22(31)29-24(21)32/h8-9,16,20-21,28H,4-7,10-15H2,1-3H3,(H,29,31,32)/t16-,20+,21?/m1/s1 |
| InChIKey | DOMIAPGWWLIZJU-DPVFXHEMSA-N |
| XLogP | 3.71 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|