C27H36F3N3O2 — CID 170208721
2-(6-methylidene-2-oxopiperidin-3-yl)-5-[[(1R,2S)-2-[(4,4,4-trifluoro-3,3-dimethylbutyl)amino]cyclohexyl]methyl]-3H-isoindol-1-one (PubChem CID 170208721) has the molecular formula C27H36F3N3O2 and a molecular weight of 491.60 g/mol. Its IUPAC name is 2-(6-methylidene-2-oxopiperidin-3-yl)-5-[[(1R,2S)-2-[(4,4,4-trifluoro-3,3-dimethylbutyl)amino]cyclohexyl]methyl]-3H-isoindol-1-one.
| Compound Name | 2-(6-methylidene-2-oxopiperidin-3-yl)-5-[[(1R,2S)-2-[(4,4,4-trifluoro-3,3-dimethylbutyl)amino]cyclohexyl]methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 170208721 |
| Molecular Formula | C27H36F3N3O2 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | 2-(6-methylidene-2-oxopiperidin-3-yl)-5-[[(1R,2S)-2-[(4,4,4-trifluoro-3,3-dimethylbutyl)amino]cyclohexyl]methyl]-3H-isoindol-1-one |
| SMILES | C=C1CCC(N2Cc3cc(C[C@H]4CCCC[C@@H]4NCCC(C)(C)C(F)(F)F)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H36F3N3O2/c1-17-8-11-23(24(34)32-17)33-16-20-15-18(9-10-21(20)25(33)35)14-19-6-4-5-7-22(19)31-13-12-26(2,3)27(28,29)30/h9-10,15,19,22-23,31H,1,4-8,11-14,16H2,2-3H3,(H,32,34)/t19-,22+,23?/m1/s1 |
| InChIKey | QLULWALTBDMBII-BSJAROSPSA-N |
| XLogP | 5.10 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |