C29H34F3N5O2 — CID 170209116
2-(6-methylidene-2-oxopiperidin-3-yl)-5-[[(1R,2S)-2-[[3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazol-6-yl]amino]cyclohexyl]methyl]-3H-isoindol-1-one (PubChem CID 170209116) has the molecular formula C29H34F3N5O2 and a molecular weight of 541.62 g/mol. Its IUPAC name is 2-(6-methylidene-2-oxopiperidin-3-yl)-5-[[(1R,2S)-2-[[3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazol-6-yl]amino]cyclohexyl]methyl]-3H-isoindol-1-one.
| Compound Name | 2-(6-methylidene-2-oxopiperidin-3-yl)-5-[[(1R,2S)-2-[[3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazol-6-yl]amino]cyclohexyl]methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 170209116 |
| Molecular Formula | C29H34F3N5O2 |
| Molecular Weight | 541.62 g/mol |
| Exact Mass | 541.27 |
| IUPAC Name | 2-(6-methylidene-2-oxopiperidin-3-yl)-5-[[(1R,2S)-2-[[3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazol-6-yl]amino]cyclohexyl]methyl]-3H-isoindol-1-one |
| SMILES | C=C1CCC(N2Cc3cc(C[C@H]4CCCC[C@@H]4NC4CCc5c(C(F)(F)F)n[nH]c5C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C29H34F3N5O2/c1-16-6-11-25(27(38)33-16)37-15-19-13-17(7-9-21(19)28(37)39)12-18-4-2-3-5-23(18)34-20-8-10-22-24(14-20)35-36-26(22)29(30,31)32/h7,9,13,18,20,23,25,34H,1-6,8,10-12,14-15H2,(H,33,38)(H,35,36)/t18-,20?,23+,25?/m1/s1 |
| InChIKey | XACANQIRKWQXJY-WMOXJJEUSA-N |
| XLogP | 4.43 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.62 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |